C29H25Cl2N3O3S — CID 21170409
N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide (PubChem CID 21170409) has the molecular formula C29H25Cl2N3O3S and a molecular weight of 566.51 g/mol. Its IUPAC name is N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21170409 |
| Molecular Formula | C29H25Cl2N3O3S |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=S)NC(=O)c3ccc(-c4cc(Cl)ccc4Cl)o3)c2)cc1 |
| InChI | InChI=1S/C29H25Cl2N3O3S/c1-29(2,3)18-9-7-17(8-10-18)26(35)32-20-5-4-6-21(16-20)33-28(38)34-27(36)25-14-13-24(37-25)22-15-19(30)11-12-23(22)31/h4-16H,1-3H3,(H,32,35)(H2,33,34,36,38) |
| InChIKey | UXRCRYOJGHURCO-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|