C19H13Cl2NO3 — CID 2892817
N-(3-acetylphenyl)-5-(2,5-dichlorophenyl)furan-2-carboxamide (PubChem CID 2892817) has the molecular formula C19H13Cl2NO3 and a molecular weight of 374.22 g/mol. Its IUPAC name is N-(3-acetylphenyl)-5-(2,5-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-(3-acetylphenyl)-5-(2,5-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2892817 |
| Molecular Formula | C19H13Cl2NO3 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N-(3-acetylphenyl)-5-(2,5-dichlorophenyl)furan-2-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc(-c3cc(Cl)ccc3Cl)o2)c1 |
| InChI | InChI=1S/C19H13Cl2NO3/c1-11(23)12-3-2-4-14(9-12)22-19(24)18-8-7-17(25-18)15-10-13(20)5-6-16(15)21/h2-10H,1H3,(H,22,24) |
| InChIKey | QYFYMDYBFMQQCC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |