C24H16Cl2N2O3 — CID 1007757
N-(3-benzamidophenyl)-5-(2,5-dichlorophenyl)furan-2-carboxamide (PubChem CID 1007757) has the molecular formula C24H16Cl2N2O3 and a molecular weight of 451.31 g/mol. Its IUPAC name is N-(3-benzamidophenyl)-5-(2,5-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-(3-benzamidophenyl)-5-(2,5-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1007757 |
| Molecular Formula | C24H16Cl2N2O3 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | N-(3-benzamidophenyl)-5-(2,5-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccc(-c3cc(Cl)ccc3Cl)o2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H16Cl2N2O3/c25-16-9-10-20(26)19(13-16)21-11-12-22(31-21)24(30)28-18-8-4-7-17(14-18)27-23(29)15-5-2-1-3-6-15/h1-14H,(H,27,29)(H,28,30) |
| InChIKey | MKYNOIOLIDIFOA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |