C27H17Cl2NO5 — CID 17117762
5-(2,3-dichlorophenyl)-N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]furan-2-carboxamide (PubChem CID 17117762) has the molecular formula C27H17Cl2NO5 and a molecular weight of 506.34 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17117762 |
| Molecular Formula | C27H17Cl2NO5 |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-[3-methoxy-4-(2-oxochromen-3-yl)phenyl]furan-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(-c3cccc(Cl)c3Cl)o2)ccc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C27H17Cl2NO5/c1-33-24-14-16(9-10-17(24)19-13-15-5-2-3-8-21(15)35-27(19)32)30-26(31)23-12-11-22(34-23)18-6-4-7-20(28)25(18)29/h2-14H,1H3,(H,30,31) |
| InChIKey | IWWRUMPYEYMLMD-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|