C18H12Cl2N2O5 — CID 1422030
5-(2,3-dichlorophenyl)-N-(4-methoxy-3-nitrophenyl)furan-2-carboxamide (PubChem CID 1422030) has the molecular formula C18H12Cl2N2O5 and a molecular weight of 407.21 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-(4-methoxy-3-nitrophenyl)furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-(4-methoxy-3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1422030 |
| Molecular Formula | C18H12Cl2N2O5 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-(4-methoxy-3-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3cccc(Cl)c3Cl)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12Cl2N2O5/c1-26-15-6-5-10(9-13(15)22(24)25)21-18(23)16-8-7-14(27-16)11-3-2-4-12(19)17(11)20/h2-9H,1H3,(H,21,23) |
| InChIKey | WTJVYELTOAIVGR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|