C19H15ClN2O6 — CID 1315583
N-(4-chloro-2,5-dimethoxyphenyl)-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 1315583) has the molecular formula C19H15ClN2O6 and a molecular weight of 402.79 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1315583 |
| Molecular Formula | C19H15ClN2O6 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(-c3ccccc3[N+](=O)[O-])o2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H15ClN2O6/c1-26-17-10-13(18(27-2)9-12(17)20)21-19(23)16-8-7-15(28-16)11-5-3-4-6-14(11)22(24)25/h3-10H,1-2H3,(H,21,23) |
| InChIKey | IKAOUXDSJBDZMP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|