C15H15ClN2O5 — CID 110699998
5-acetamido-N-(4-chloro-2,5-dimethoxyphenyl)furan-2-carboxamide (PubChem CID 110699998) has the molecular formula C15H15ClN2O5 and a molecular weight of 338.75 g/mol. Its IUPAC name is 5-acetamido-N-(4-chloro-2,5-dimethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-acetamido-N-(4-chloro-2,5-dimethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110699998 |
| Molecular Formula | C15H15ClN2O5 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 5-acetamido-N-(4-chloro-2,5-dimethoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(NC(C)=O)o2)c(OC)cc1Cl |
| InChI | InChI=1S/C15H15ClN2O5/c1-8(19)17-14-5-4-11(23-14)15(20)18-10-7-12(21-2)9(16)6-13(10)22-3/h4-7H,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | RLVDDTNDWOQRFG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |