C14H14ClNO4 — CID 18139943
N-(2-chloro-4,5-dimethoxyphenyl)-5-methylfuran-2-carboxamide (PubChem CID 18139943) has the molecular formula C14H14ClNO4 and a molecular weight of 295.72 g/mol. Its IUPAC name is N-(2-chloro-4,5-dimethoxyphenyl)-5-methylfuran-2-carboxamide.
| Compound Name | N-(2-chloro-4,5-dimethoxyphenyl)-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 18139943 |
| Molecular Formula | C14H14ClNO4 |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(2-chloro-4,5-dimethoxyphenyl)-5-methylfuran-2-carboxamide |
| SMILES | COc1cc(Cl)c(NC(=O)c2ccc(C)o2)cc1OC |
| InChI | InChI=1S/C14H14ClNO4/c1-8-4-5-11(20-8)14(17)16-10-7-13(19-3)12(18-2)6-9(10)15/h4-7H,1-3H3,(H,16,17) |
| InChIKey | KMOJOQHKEQNYDR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |