C15H16N2O4 — CID 110699937
5-acetamido-N-(2-methoxy-5-methylphenyl)furan-2-carboxamide (PubChem CID 110699937) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 5-acetamido-N-(2-methoxy-5-methylphenyl)furan-2-carboxamide.
| Compound Name | 5-acetamido-N-(2-methoxy-5-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110699937 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 5-acetamido-N-(2-methoxy-5-methylphenyl)furan-2-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)c1ccc(NC(C)=O)o1 |
| InChI | InChI=1S/C15H16N2O4/c1-9-4-5-12(20-3)11(8-9)17-15(19)13-6-7-14(21-13)16-10(2)18/h4-8H,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | ZFODXKHPAPTKQT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |