C20H17ClFNO4 — CID 19452910
5-[(2-chloro-4-fluorophenoxy)methyl]-N-(2-methoxy-5-methylphenyl)furan-2-carboxamide (PubChem CID 19452910) has the molecular formula C20H17ClFNO4 and a molecular weight of 389.81 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorophenoxy)methyl]-N-(2-methoxy-5-methylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-fluorophenoxy)methyl]-N-(2-methoxy-5-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19452910 |
| Molecular Formula | C20H17ClFNO4 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 5-[(2-chloro-4-fluorophenoxy)methyl]-N-(2-methoxy-5-methylphenyl)furan-2-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)c1ccc(COc2ccc(F)cc2Cl)o1 |
| InChI | InChI=1S/C20H17ClFNO4/c1-12-3-6-18(25-2)16(9-12)23-20(24)19-8-5-14(27-19)11-26-17-7-4-13(22)10-15(17)21/h3-10H,11H2,1-2H3,(H,23,24) |
| InChIKey | WVXPIADLTSRHEI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |