C18H21ClFNO3 — CID 19452883
5-[(2-chloro-4-fluorophenoxy)methyl]-N-hexylfuran-2-carboxamide (PubChem CID 19452883) has the molecular formula C18H21ClFNO3 and a molecular weight of 353.82 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorophenoxy)methyl]-N-hexylfuran-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-fluorophenoxy)methyl]-N-hexylfuran-2-carboxamide |
|---|---|
| PubChem CID | 19452883 |
| Molecular Formula | C18H21ClFNO3 |
| Molecular Weight | 353.82 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 5-[(2-chloro-4-fluorophenoxy)methyl]-N-hexylfuran-2-carboxamide |
| SMILES | CCCCCCNC(=O)c1ccc(COc2ccc(F)cc2Cl)o1 |
| InChI | InChI=1S/C18H21ClFNO3/c1-2-3-4-5-10-21-18(22)17-9-7-14(24-17)12-23-16-8-6-13(20)11-15(16)19/h6-9,11H,2-5,10,12H2,1H3,(H,21,22) |
| InChIKey | SBHDVXNJQFZIRH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.82 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|