C20H18ClF4N3O3 — CID 19295718
5-[(2-chloro-4-fluorophenoxy)methyl]-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]furan-2-carboxamide (PubChem CID 19295718) has the molecular formula C20H18ClF4N3O3 and a molecular weight of 459.83 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorophenoxy)methyl]-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]furan-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-fluorophenoxy)methyl]-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19295718 |
| Molecular Formula | C20H18ClF4N3O3 |
| Molecular Weight | 459.83 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 5-[(2-chloro-4-fluorophenoxy)methyl]-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]furan-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)nn1CCCNC(=O)c1ccc(COc2ccc(F)cc2Cl)o1 |
| InChI | InChI=1S/C20H18ClF4N3O3/c1-12-9-18(20(23,24)25)27-28(12)8-2-7-26-19(29)17-6-4-14(31-17)11-30-16-5-3-13(22)10-15(16)21/h3-6,9-10H,2,7-8,11H2,1H3,(H,26,29) |
| InChIKey | QADQEHIACDYWNE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|