C18H16Cl2FN3O3 — CID 19330322
5-[(2-chloro-4-fluorophenoxy)methyl]-N-[3-(4-chloropyrazol-1-yl)propyl]furan-2-carboxamide (PubChem CID 19330322) has the molecular formula C18H16Cl2FN3O3 and a molecular weight of 412.25 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorophenoxy)methyl]-N-[3-(4-chloropyrazol-1-yl)propyl]furan-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-fluorophenoxy)methyl]-N-[3-(4-chloropyrazol-1-yl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19330322 |
| Molecular Formula | C18H16Cl2FN3O3 |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 5-[(2-chloro-4-fluorophenoxy)methyl]-N-[3-(4-chloropyrazol-1-yl)propyl]furan-2-carboxamide |
| SMILES | O=C(NCCCn1cc(Cl)cn1)c1ccc(COc2ccc(F)cc2Cl)o1 |
| InChI | InChI=1S/C18H16Cl2FN3O3/c19-12-9-23-24(10-12)7-1-6-22-18(25)17-5-3-14(27-17)11-26-16-4-2-13(21)8-15(16)20/h2-5,8-10H,1,6-7,11H2,(H,22,25) |
| InChIKey | KWALLHZYLWVRJV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|