C15H13ClFNO5 — CID 19453002
methyl 2-[[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carbonyl]amino]acetate (PubChem CID 19453002) has the molecular formula C15H13ClFNO5 and a molecular weight of 341.72 g/mol. Its IUPAC name is methyl 2-[[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 19453002 |
| Molecular Formula | C15H13ClFNO5 |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | methyl 2-[[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(COc2ccc(F)cc2Cl)o1 |
| InChI | InChI=1S/C15H13ClFNO5/c1-21-14(19)7-18-15(20)13-5-3-10(23-13)8-22-12-4-2-9(17)6-11(12)16/h2-6H,7-8H2,1H3,(H,18,20) |
| InChIKey | GYXWZLOUJUMESA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |