C14H13Cl2NO3 — CID 19456984
5-[(2,4-dichlorophenoxy)methyl]-N-ethylfuran-2-carboxamide (PubChem CID 19456984) has the molecular formula C14H13Cl2NO3 and a molecular weight of 314.17 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenoxy)methyl]-N-ethylfuran-2-carboxamide.
| Compound Name | 5-[(2,4-dichlorophenoxy)methyl]-N-ethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 19456984 |
| Molecular Formula | C14H13Cl2NO3 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 5-[(2,4-dichlorophenoxy)methyl]-N-ethylfuran-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(COc2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C14H13Cl2NO3/c1-2-17-14(18)13-6-4-10(20-13)8-19-12-5-3-9(15)7-11(12)16/h3-7H,2,8H2,1H3,(H,17,18) |
| InChIKey | CEPLSCGMGDTUQG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |