C14H11F4NO3 — CID 19457368
N-ethyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19457368) has the molecular formula C14H11F4NO3 and a molecular weight of 317.24 g/mol. Its IUPAC name is N-ethyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-ethyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19457368 |
| Molecular Formula | C14H11F4NO3 |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-ethyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(COc2c(F)c(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C14H11F4NO3/c1-2-19-14(20)10-4-3-7(22-10)6-21-13-11(17)8(15)5-9(16)12(13)18/h3-5H,2,6H2,1H3,(H,19,20) |
| InChIKey | APXFBFXXXKRLTJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|