C18H15F4N3O3 — CID 19332332
N-(3-pyrazol-1-ylpropyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19332332) has the molecular formula C18H15F4N3O3 and a molecular weight of 397.33 g/mol. Its IUPAC name is N-(3-pyrazol-1-ylpropyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(3-pyrazol-1-ylpropyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19332332 |
| Molecular Formula | C18H15F4N3O3 |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-(3-pyrazol-1-ylpropyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(NCCCn1cccn1)c1ccc(COc2c(F)c(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C18H15F4N3O3/c19-12-9-13(20)16(22)17(15(12)21)27-10-11-3-4-14(28-11)18(26)23-5-1-7-25-8-2-6-24-25/h2-4,6,8-9H,1,5,7,10H2,(H,23,26) |
| InChIKey | DAATXWHKGUNNQX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|