C23H17F4N3O4 — CID 19410195
N-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19410195) has the molecular formula C23H17F4N3O4 and a molecular weight of 475.40 g/mol. Its IUPAC name is N-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19410195 |
| Molecular Formula | C23H17F4N3O4 |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | N-[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | COc1cccc(Cn2cc(NC(=O)c3ccc(COc4c(F)c(F)cc(F)c4F)o3)cn2)c1 |
| InChI | InChI=1S/C23H17F4N3O4/c1-32-15-4-2-3-13(7-15)10-30-11-14(9-28-30)29-23(31)19-6-5-16(34-19)12-33-22-20(26)17(24)8-18(25)21(22)27/h2-9,11H,10,12H2,1H3,(H,29,31) |
| InChIKey | KTLAYVOEVSWUQT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|