C24H16ClF4N3O2 — CID 19338284
N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzamide (PubChem CID 19338284) has the molecular formula C24H16ClF4N3O2 and a molecular weight of 489.86 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzamide.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19338284 |
| Molecular Formula | C24H16ClF4N3O2 |
| Molecular Weight | 489.86 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzamide |
| SMILES | O=C(Nc1cnn(Cc2cccc(Cl)c2)c1)c1ccc(COc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C24H16ClF4N3O2/c25-17-3-1-2-15(8-17)11-32-12-18(10-30-32)31-24(33)16-6-4-14(5-7-16)13-34-23-21(28)19(26)9-20(27)22(23)29/h1-10,12H,11,13H2,(H,31,33) |
| InChIKey | HPHDEXOFGCREED-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.86 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|