C19H13Cl2NO5 — CID 126203909
4-[[5-[(2,4-dichlorophenoxy)methyl]furan-2-carbonyl]amino]benzoic acid (PubChem CID 126203909) has the molecular formula C19H13Cl2NO5 and a molecular weight of 406.22 g/mol. Its IUPAC name is 4-[[5-[(2,4-dichlorophenoxy)methyl]furan-2-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[5-[(2,4-dichlorophenoxy)methyl]furan-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 126203909 |
| Molecular Formula | C19H13Cl2NO5 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 4-[[5-[(2,4-dichlorophenoxy)methyl]furan-2-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccc(COc3ccc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C19H13Cl2NO5/c20-12-3-7-16(15(21)9-12)26-10-14-6-8-17(27-14)18(23)22-13-4-1-11(2-5-13)19(24)25/h1-9H,10H2,(H,22,23)(H,24,25) |
| InChIKey | MCPJPVGSCJSOMR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |