C24H16Cl3NO3 — CID 19415524
N-(4-phenylphenyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19415524) has the molecular formula C24H16Cl3NO3 and a molecular weight of 472.76 g/mol. Its IUPAC name is N-(4-phenylphenyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(4-phenylphenyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19415524 |
| Molecular Formula | C24H16Cl3NO3 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | N-(4-phenylphenyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)c1ccc(COc2c(Cl)cc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C24H16Cl3NO3/c25-17-12-20(26)23(21(27)13-17)30-14-19-10-11-22(31-19)24(29)28-18-8-6-16(7-9-18)15-4-2-1-3-5-15/h1-13H,14H2,(H,28,29) |
| InChIKey | LIPVJIDJHPLWBH-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |