C15H10Cl5NO5 — CID 19465918
methyl 2-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]acetate (PubChem CID 19465918) has the molecular formula C15H10Cl5NO5 and a molecular weight of 461.51 g/mol. Its IUPAC name is methyl 2-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 19465918 |
| Molecular Formula | C15H10Cl5NO5 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 458.90 |
| IUPAC Name | methyl 2-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C15H10Cl5NO5/c1-24-8(22)4-21-15(23)7-3-2-6(26-7)5-25-14-12(19)10(17)9(16)11(18)13(14)20/h2-3H,4-5H2,1H3,(H,21,23) |
| InChIKey | GTTSGOJUIBELFL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|