C19H21Cl5N2O3 — CID 19465978
N-[3-(diethylamino)propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19465978) has the molecular formula C19H21Cl5N2O3 and a molecular weight of 502.65 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19465978 |
| Molecular Formula | C19H21Cl5N2O3 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | N-[3-(diethylamino)propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C19H21Cl5N2O3/c1-3-26(4-2)9-5-8-25-19(27)12-7-6-11(29-12)10-28-18-16(23)14(21)13(20)15(22)17(18)24/h6-7H,3-5,8-10H2,1-2H3,(H,25,27) |
| InChIKey | ZCZQMPSLJTZGFF-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|