C22H32N4O3S — CID 4865160
1-[3-(diethylamino)propyl]-3-[[5-[(2,4-dimethylphenoxy)methyl]furan-2-carbonyl]amino]thiourea (PubChem CID 4865160) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[[5-[(2,4-dimethylphenoxy)methyl]furan-2-carbonyl]amino]thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[[5-[(2,4-dimethylphenoxy)methyl]furan-2-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 4865160 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[[5-[(2,4-dimethylphenoxy)methyl]furan-2-carbonyl]amino]thiourea |
| SMILES | CCN(CC)CCCNC(=S)NNC(=O)c1ccc(COc2ccc(C)cc2C)o1 |
| InChI | InChI=1S/C22H32N4O3S/c1-5-26(6-2)13-7-12-23-22(30)25-24-21(27)20-11-9-18(29-20)15-28-19-10-8-16(3)14-17(19)4/h8-11,14H,5-7,12-13,15H2,1-4H3,(H,24,27)(H2,23,25,30) |
| InChIKey | ZUAIPCOHGYVWCQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|