C19H25IN2O3 — CID 19446041
N-[3-(diethylamino)propyl]-5-[(4-iodophenoxy)methyl]furan-2-carboxamide (PubChem CID 19446041) has the molecular formula C19H25IN2O3 and a molecular weight of 456.32 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-5-[(4-iodophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-5-[(4-iodophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446041 |
| Molecular Formula | C19H25IN2O3 |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | N-[3-(diethylamino)propyl]-5-[(4-iodophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc(COc2ccc(I)cc2)o1 |
| InChI | InChI=1S/C19H25IN2O3/c1-3-22(4-2)13-5-12-21-19(23)18-11-10-17(25-18)14-24-16-8-6-15(20)7-9-16/h6-11H,3-5,12-14H2,1-2H3,(H,21,23) |
| InChIKey | JBWBFZDEHAHAPS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|