C20H24ClNO4 — CID 19452402
4-[[5-[(4-tert-butylphenoxy)methyl]furan-2-carbonyl]amino]butanoyl chloride (PubChem CID 19452402) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is 4-[[5-[(4-tert-butylphenoxy)methyl]furan-2-carbonyl]amino]butanoyl chloride.
| Compound Name | 4-[[5-[(4-tert-butylphenoxy)methyl]furan-2-carbonyl]amino]butanoyl chloride |
|---|---|
| PubChem CID | 19452402 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-[[5-[(4-tert-butylphenoxy)methyl]furan-2-carbonyl]amino]butanoyl chloride |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(C(=O)NCCCC(=O)Cl)o2)cc1 |
| InChI | InChI=1S/C20H24ClNO4/c1-20(2,3)14-6-8-15(9-7-14)25-13-16-10-11-17(26-16)19(24)22-12-4-5-18(21)23/h6-11H,4-5,12-13H2,1-3H3,(H,22,24) |
| InChIKey | BWEVUDMYHMIPMC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|