C25H29NO3 — CID 19455453
N-(2-methylpropyl)-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 19455453) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is N-(2-methylpropyl)-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-(2-methylpropyl)-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19455453 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-(2-methylpropyl)-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CC(C)CNC(=O)c1ccc(COc2ccc(C(C)(C)c3ccccc3)cc2)o1 |
| InChI | InChI=1S/C25H29NO3/c1-18(2)16-26-24(27)23-15-14-22(29-23)17-28-21-12-10-20(11-13-21)25(3,4)19-8-6-5-7-9-19/h5-15,18H,16-17H2,1-4H3,(H,26,27) |
| InChIKey | YSRANRCEPBNANE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |