C25H29NO4 — CID 19457169
N-(3-methoxypropyl)-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 19457169) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-(3-methoxypropyl)-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-(3-methoxypropyl)-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19457169 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-(3-methoxypropyl)-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(COc2ccc(C(C)(C)c3ccccc3)cc2)o1 |
| InChI | InChI=1S/C25H29NO4/c1-25(2,19-8-5-4-6-9-19)20-10-12-21(13-11-20)29-18-22-14-15-23(30-22)24(27)26-16-7-17-28-3/h4-6,8-15H,7,16-18H2,1-3H3,(H,26,27) |
| InChIKey | FZXRSGLIJAMBMM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|