C31H34N2O3 — CID 19455393
N-[4-(diethylamino)phenyl]-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 19455393) has the molecular formula C31H34N2O3 and a molecular weight of 482.62 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19455393 |
| Molecular Formula | C31H34N2O3 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccc(COc3ccc(C(C)(C)c4ccccc4)cc3)o2)cc1 |
| InChI | InChI=1S/C31H34N2O3/c1-5-33(6-2)26-16-14-25(15-17-26)32-30(34)29-21-20-28(36-29)22-35-27-18-12-24(13-19-27)31(3,4)23-10-8-7-9-11-23/h7-21H,5-6,22H2,1-4H3,(H,32,34) |
| InChIKey | RYSAIQIKFPNHNX-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|