C26H24N2O3 — CID 19455416
5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]-N-pyridin-4-ylfuran-2-carboxamide (PubChem CID 19455416) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]-N-pyridin-4-ylfuran-2-carboxamide.
| Compound Name | 5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]-N-pyridin-4-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 19455416 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]-N-pyridin-4-ylfuran-2-carboxamide |
| SMILES | CC(C)(c1ccccc1)c1ccc(OCc2ccc(C(=O)Nc3ccncc3)o2)cc1 |
| InChI | InChI=1S/C26H24N2O3/c1-26(2,19-6-4-3-5-7-19)20-8-10-22(11-9-20)30-18-23-12-13-24(31-23)25(29)28-21-14-16-27-17-15-21/h3-17H,18H2,1-2H3,(H,27,28,29) |
| InChIKey | PHULSAMEZJOUAC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |