C17H13IN2O3 — CID 19417254
5-[(4-iodophenoxy)methyl]-N-pyridin-4-ylfuran-2-carboxamide (PubChem CID 19417254) has the molecular formula C17H13IN2O3 and a molecular weight of 420.21 g/mol. Its IUPAC name is 5-[(4-iodophenoxy)methyl]-N-pyridin-4-ylfuran-2-carboxamide.
| Compound Name | 5-[(4-iodophenoxy)methyl]-N-pyridin-4-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 19417254 |
| Molecular Formula | C17H13IN2O3 |
| Molecular Weight | 420.21 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | 5-[(4-iodophenoxy)methyl]-N-pyridin-4-ylfuran-2-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1ccc(COc2ccc(I)cc2)o1 |
| InChI | InChI=1S/C17H13IN2O3/c18-12-1-3-14(4-2-12)22-11-15-5-6-16(23-15)17(21)20-13-7-9-19-10-8-13/h1-10H,11H2,(H,19,20,21) |
| InChIKey | ZWHPCPGWQZXTSJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|