C19H13IN2O3 — CID 19440079
N-(2-cyanophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide (PubChem CID 19440079) has the molecular formula C19H13IN2O3 and a molecular weight of 444.23 g/mol. Its IUPAC name is N-(2-cyanophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(2-cyanophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19440079 |
| Molecular Formula | C19H13IN2O3 |
| Molecular Weight | 444.23 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | N-(2-cyanophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1ccc(COc2ccc(I)cc2)o1 |
| InChI | InChI=1S/C19H13IN2O3/c20-14-5-7-15(8-6-14)24-12-16-9-10-18(25-16)19(23)22-17-4-2-1-3-13(17)11-21/h1-10H,12H2,(H,22,23) |
| InChIKey | FFCJWXBHXAQQQG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|