C19H15IN2O6 — CID 19417299
5-[(4-iodophenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)furan-2-carboxamide (PubChem CID 19417299) has the molecular formula C19H15IN2O6 and a molecular weight of 494.24 g/mol. Its IUPAC name is 5-[(4-iodophenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-iodophenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19417299 |
| Molecular Formula | C19H15IN2O6 |
| Molecular Weight | 494.24 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 5-[(4-iodophenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)c1ccc(COc2ccc(I)cc2)o1 |
| InChI | InChI=1S/C19H15IN2O6/c1-26-18-10-13(22(24)25)4-8-16(18)21-19(23)17-9-7-15(28-17)11-27-14-5-2-12(20)3-6-14/h2-10H,11H2,1H3,(H,21,23) |
| InChIKey | RWGIXCUOPHDIJC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|