C18H13IN2O6 — CID 19446066
N-(2-hydroxy-5-nitrophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide (PubChem CID 19446066) has the molecular formula C18H13IN2O6 and a molecular weight of 480.21 g/mol. Its IUPAC name is N-(2-hydroxy-5-nitrophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(2-hydroxy-5-nitrophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446066 |
| Molecular Formula | C18H13IN2O6 |
| Molecular Weight | 480.21 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | N-(2-hydroxy-5-nitrophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1O)c1ccc(COc2ccc(I)cc2)o1 |
| InChI | InChI=1S/C18H13IN2O6/c19-11-1-4-13(5-2-11)26-10-14-6-8-17(27-14)18(23)20-15-9-12(21(24)25)3-7-16(15)22/h1-9,22H,10H2,(H,20,23) |
| InChIKey | YMWKTMLPMXJAKO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.21 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|