C18H13ClFNO4 — CID 19413042
N-(5-chloro-2-hydroxyphenyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19413042) has the molecular formula C18H13ClFNO4 and a molecular weight of 361.76 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19413042 |
| Molecular Formula | C18H13ClFNO4 |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C18H13ClFNO4/c19-11-1-7-16(22)15(9-11)21-18(23)17-8-6-14(25-17)10-24-13-4-2-12(20)3-5-13/h1-9,22H,10H2,(H,21,23) |
| InChIKey | ZPWHOWLHXHJUDS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|