C25H17ClINO4 — CID 19417251
N-(2-benzoyl-4-chlorophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide (PubChem CID 19417251) has the molecular formula C25H17ClINO4 and a molecular weight of 557.77 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19417251 |
| Molecular Formula | C25H17ClINO4 |
| Molecular Weight | 557.77 g/mol |
| Exact Mass | 556.99 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-5-[(4-iodophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(=O)c1ccccc1)c1ccc(COc2ccc(I)cc2)o1 |
| InChI | InChI=1S/C25H17ClINO4/c26-17-6-12-22(21(14-17)24(29)16-4-2-1-3-5-16)28-25(30)23-13-11-20(32-23)15-31-19-9-7-18(27)8-10-19/h1-14H,15H2,(H,28,30) |
| InChIKey | GVWPFUGXQCFALQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.77 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|