C25H17ClFNO3S — CID 19469408
N-(2-benzoyl-4-chlorophenyl)-4-[(4-fluorophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19469408) has the molecular formula C25H17ClFNO3S and a molecular weight of 465.93 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-4-[(4-fluorophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-4-[(4-fluorophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19469408 |
| Molecular Formula | C25H17ClFNO3S |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-4-[(4-fluorophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(=O)c1ccccc1)c1cc(COc2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C25H17ClFNO3S/c26-18-6-11-22(21(13-18)24(29)17-4-2-1-3-5-17)28-25(30)23-12-16(15-32-23)14-31-20-9-7-19(27)8-10-20/h1-13,15H,14H2,(H,28,30) |
| InChIKey | FILBQMFZESJSCV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |