C17H13ClN2O2S — CID 19503359
4-[(4-chlorophenoxy)methyl]-N-pyridin-2-ylthiophene-2-carboxamide (PubChem CID 19503359) has the molecular formula C17H13ClN2O2S and a molecular weight of 344.82 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]-N-pyridin-2-ylthiophene-2-carboxamide.
| Compound Name | 4-[(4-chlorophenoxy)methyl]-N-pyridin-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 19503359 |
| Molecular Formula | C17H13ClN2O2S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]-N-pyridin-2-ylthiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cc(COc2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C17H13ClN2O2S/c18-13-4-6-14(7-5-13)22-10-12-9-15(23-11-12)17(21)20-16-3-1-2-8-19-16/h1-9,11H,10H2,(H,19,20,21) |
| InChIKey | FEOAYDCHRZFHNI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |