C19H9ClF7NO2S — CID 19503366
4-[(4-chlorophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 19503366) has the molecular formula C19H9ClF7NO2S and a molecular weight of 483.79 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 4-[(4-chlorophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19503366 |
| Molecular Formula | C19H9ClF7NO2S |
| Molecular Weight | 483.79 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1cc(COc2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C19H9ClF7NO2S/c20-9-1-3-10(4-2-9)30-6-8-5-11(31-7-8)18(29)28-17-15(23)13(21)12(19(25,26)27)14(22)16(17)24/h1-5,7H,6H2,(H,28,29) |
| InChIKey | RIZWJNKDCZSCOL-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.79 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|