C18H20ClNO2S — CID 19503355
4-[(4-chlorophenoxy)methyl]-N-cyclohexylthiophene-2-carboxamide (PubChem CID 19503355) has the molecular formula C18H20ClNO2S and a molecular weight of 349.88 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]-N-cyclohexylthiophene-2-carboxamide.
| Compound Name | 4-[(4-chlorophenoxy)methyl]-N-cyclohexylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 19503355 |
| Molecular Formula | C18H20ClNO2S |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]-N-cyclohexylthiophene-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(COc2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C18H20ClNO2S/c19-14-6-8-16(9-7-14)22-11-13-10-17(23-12-13)18(21)20-15-4-2-1-3-5-15/h6-10,12,15H,1-5,11H2,(H,20,21) |
| InChIKey | GDPOTBDAIHNSIW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |