C20H25NO3S — CID 19499174
N-cycloheptyl-4-[(4-methoxyphenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19499174) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is N-cycloheptyl-4-[(4-methoxyphenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-cycloheptyl-4-[(4-methoxyphenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19499174 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-cycloheptyl-4-[(4-methoxyphenoxy)methyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(OCc2csc(C(=O)NC3CCCCCC3)c2)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-23-17-8-10-18(11-9-17)24-13-15-12-19(25-14-15)20(22)21-16-6-4-2-3-5-7-16/h8-12,14,16H,2-7,13H2,1H3,(H,21,22) |
| InChIKey | UXXRVEYYENCMNM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |