C26H20ClNO3S — CID 19492917
N-(2-benzoyl-4-chlorophenyl)-4-[(4-methylphenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19492917) has the molecular formula C26H20ClNO3S and a molecular weight of 461.97 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-4-[(4-methylphenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-4-[(4-methylphenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19492917 |
| Molecular Formula | C26H20ClNO3S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-4-[(4-methylphenoxy)methyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(OCc2csc(C(=O)Nc3ccc(Cl)cc3C(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H20ClNO3S/c1-17-7-10-21(11-8-17)31-15-18-13-24(32-16-18)26(30)28-23-12-9-20(27)14-22(23)25(29)19-5-3-2-4-6-19/h2-14,16H,15H2,1H3,(H,28,30) |
| InChIKey | PMCJHPKJDNZNHA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |