C18H9ClF5NO4 — CID 19459751
N-(5-chloro-2-hydroxyphenyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19459751) has the molecular formula C18H9ClF5NO4 and a molecular weight of 433.72 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19459751 |
| Molecular Formula | C18H9ClF5NO4 |
| Molecular Weight | 433.72 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1ccc(COc2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C18H9ClF5NO4/c19-7-1-3-10(26)9(5-7)25-18(27)11-4-2-8(29-11)6-28-17-15(23)13(21)12(20)14(22)16(17)24/h1-5,26H,6H2,(H,25,27) |
| InChIKey | YDPMSIZDKGIKEP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.72 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|