C21H20ClNO6 — CID 21048103
N-(5-chloro-2-hydroxyphenyl)-5-[(2,4,6-trimethoxyphenyl)methyl]furan-2-carboxamide (PubChem CID 21048103) has the molecular formula C21H20ClNO6 and a molecular weight of 417.85 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-5-[(2,4,6-trimethoxyphenyl)methyl]furan-2-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-5-[(2,4,6-trimethoxyphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21048103 |
| Molecular Formula | C21H20ClNO6 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-5-[(2,4,6-trimethoxyphenyl)methyl]furan-2-carboxamide |
| SMILES | COc1cc(OC)c(Cc2ccc(C(=O)Nc3cc(Cl)ccc3O)o2)c(OC)c1 |
| InChI | InChI=1S/C21H20ClNO6/c1-26-14-10-19(27-2)15(20(11-14)28-3)9-13-5-7-18(29-13)21(25)23-16-8-12(22)4-6-17(16)24/h4-8,10-11,24H,9H2,1-3H3,(H,23,25) |
| InChIKey | IMLUPCHHHRMPNW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|