C28H24N2O5 — CID 21048254
N-acridin-9-yl-5-[(2,4,6-trimethoxyphenyl)methyl]furan-2-carboxamide (PubChem CID 21048254) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is N-acridin-9-yl-5-[(2,4,6-trimethoxyphenyl)methyl]furan-2-carboxamide.
| Compound Name | N-acridin-9-yl-5-[(2,4,6-trimethoxyphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21048254 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-acridin-9-yl-5-[(2,4,6-trimethoxyphenyl)methyl]furan-2-carboxamide |
| SMILES | COc1cc(OC)c(Cc2ccc(C(=O)Nc3c4ccccc4nc4ccccc34)o2)c(OC)c1 |
| InChI | InChI=1S/C28H24N2O5/c1-32-18-15-25(33-2)21(26(16-18)34-3)14-17-12-13-24(35-17)28(31)30-27-19-8-4-6-10-22(19)29-23-11-7-5-9-20(23)27/h4-13,15-16H,14H2,1-3H3,(H,29,30,31) |
| InChIKey | ILIBFPQDLAMRAT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|