C15H15NO5 — CID 126200596
3-[[5-(phenoxymethyl)furan-2-carbonyl]amino]propanoic acid (PubChem CID 126200596) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 3-[[5-(phenoxymethyl)furan-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[5-(phenoxymethyl)furan-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 126200596 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-[[5-(phenoxymethyl)furan-2-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C15H15NO5/c17-14(18)8-9-16-15(19)13-7-6-12(21-13)10-20-11-4-2-1-3-5-11/h1-7H,8-10H2,(H,16,19)(H,17,18) |
| InChIKey | BBTZCEBQLZEXLB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |