C18H19N3O3 — CID 9463031
N-(3-imidazol-1-ylpropyl)-5-(phenoxymethyl)furan-2-carboxamide (PubChem CID 9463031) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-5-(phenoxymethyl)furan-2-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-5-(phenoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 9463031 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-5-(phenoxymethyl)furan-2-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C18H19N3O3/c22-18(20-9-4-11-21-12-10-19-14-21)17-8-7-16(24-17)13-23-15-5-2-1-3-6-15/h1-3,5-8,10,12,14H,4,9,11,13H2,(H,20,22) |
| InChIKey | OHQFAFCYKJAICJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|