C19H20ClN3O3 — CID 35294139
5-[(4-chloro-3-methylphenoxy)methyl]-N-(3-imidazol-1-ylpropyl)furan-2-carboxamide (PubChem CID 35294139) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is 5-[(4-chloro-3-methylphenoxy)methyl]-N-(3-imidazol-1-ylpropyl)furan-2-carboxamide.
| Compound Name | 5-[(4-chloro-3-methylphenoxy)methyl]-N-(3-imidazol-1-ylpropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 35294139 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 5-[(4-chloro-3-methylphenoxy)methyl]-N-(3-imidazol-1-ylpropyl)furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)NCCCn3ccnc3)o2)ccc1Cl |
| InChI | InChI=1S/C19H20ClN3O3/c1-14-11-15(3-5-17(14)20)25-12-16-4-6-18(26-16)19(24)22-7-2-9-23-10-8-21-13-23/h3-6,8,10-11,13H,2,7,9,12H2,1H3,(H,22,24) |
| InChIKey | VFTPWCSUXUBYLY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|