C21H23Cl2N3O3 — CID 19417083
N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19417083) has the molecular formula C21H23Cl2N3O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19417083 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)NCCCn3nc(C)c(Cl)c3C)o2)ccc1Cl |
| InChI | InChI=1S/C21H23Cl2N3O3/c1-13-11-16(5-7-18(13)22)28-12-17-6-8-19(29-17)21(27)24-9-4-10-26-15(3)20(23)14(2)25-26/h5-8,11H,4,9-10,12H2,1-3H3,(H,24,27) |
| InChIKey | AHHNDHSRHIJDSQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|