C17H21NO4 — CID 717010
5-[(2-methoxyphenoxy)methyl]-N-(2-methylpropyl)furan-2-carboxamide (PubChem CID 717010) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-[(2-methoxyphenoxy)methyl]-N-(2-methylpropyl)furan-2-carboxamide.
| Compound Name | 5-[(2-methoxyphenoxy)methyl]-N-(2-methylpropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 717010 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 5-[(2-methoxyphenoxy)methyl]-N-(2-methylpropyl)furan-2-carboxamide |
| SMILES | COc1ccccc1OCc1ccc(C(=O)NCC(C)C)o1 |
| InChI | InChI=1S/C17H21NO4/c1-12(2)10-18-17(19)16-9-8-13(22-16)11-21-15-7-5-4-6-14(15)20-3/h4-9,12H,10-11H2,1-3H3,(H,18,19) |
| InChIKey | JMMSOYLHAVSXQA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |